C15H15F3N2O2S — CID 47045100
4-methoxy-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 47045100) has the molecular formula C15H15F3N2O2S and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-methoxy-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-methoxy-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 47045100 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-methoxy-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | COCCCC(=O)Nc1nc(-c2cccc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C15H15F3N2O2S/c1-22-7-3-6-13(21)20-14-19-12(9-23-14)10-4-2-5-11(8-10)15(16,17)18/h2,4-5,8-9H,3,6-7H2,1H3,(H,19,20,21) |
| InChIKey | ZRBBTECBWTWVBN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|