C19H28N4O4S — CID 176652783
[4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl] N-tert-butylcarbamate;methanol (PubChem CID 176652783) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is [4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl] N-tert-butylcarbamate;methanol.
| Compound Name | [4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl] N-tert-butylcarbamate;methanol |
|---|---|
| PubChem CID | 176652783 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-4-oxobutyl] N-tert-butylcarbamate;methanol |
| SMILES | CC(C)(C)NC(=O)OCCCC(=O)Nc1nc(-c2cccc(N)c2)cs1.CO |
| InChI | InChI=1S/C18H24N4O3S.CH4O/c1-18(2,3)22-17(24)25-9-5-8-15(23)21-16-20-14(11-26-16)12-6-4-7-13(19)10-12;1-2/h4,6-7,10-11H,5,8-9,19H2,1-3H3,(H,22,24)(H,20,21,23);2H,1H3 |
| InChIKey | MIMYWGAIFCRINA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|