C21H30N4O6S — CID 176652780
methanol;[6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-6-oxohexyl] N-tert-butylcarbamate (PubChem CID 176652780) has the molecular formula C21H30N4O6S and a molecular weight of 466.56 g/mol. Its IUPAC name is methanol;[6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-6-oxohexyl] N-tert-butylcarbamate.
| Compound Name | methanol;[6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-6-oxohexyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 176652780 |
| Molecular Formula | C21H30N4O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | methanol;[6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-6-oxohexyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCCCC(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1.CO |
| InChI | InChI=1S/C20H26N4O5S.CH4O/c1-20(2,3)23-19(26)29-11-6-4-5-10-17(25)22-18-21-16(13-30-18)14-8-7-9-15(12-14)24(27)28;1-2/h7-9,12-13H,4-6,10-11H2,1-3H3,(H,23,26)(H,21,22,25);2H,1H3 |
| InChIKey | SGPGFAVWJVIJFL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|