C18H23N3O3S — CID 4874226
N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]nonanamide (PubChem CID 4874226) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]nonanamide.
| Compound Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]nonanamide |
|---|---|
| PubChem CID | 4874226 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]nonanamide |
| SMILES | CCCCCCCCC(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C18H23N3O3S/c1-2-3-4-5-6-7-11-17(22)20-18-19-16(13-25-18)14-9-8-10-15(12-14)21(23)24/h8-10,12-13H,2-7,11H2,1H3,(H,19,20,22) |
| InChIKey | DRLCYSJWBBDTOV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|