C14H12N6O3S3 — CID 23861696
3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 23861696) has the molecular formula C14H12N6O3S3 and a molecular weight of 408.49 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 23861696 |
| Molecular Formula | C14H12N6O3S3 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Nc1nnc(SCCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)s1 |
| InChI | InChI=1S/C14H12N6O3S3/c15-12-18-19-14(26-12)24-5-4-11(21)17-13-16-10(7-25-13)8-2-1-3-9(6-8)20(22)23/h1-3,6-7H,4-5H2,(H2,15,18)(H,16,17,21) |
| InChIKey | PNBVEHDRTDCJDY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|