C22H21N5O3S2 — CID 23746182
3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 23746182) has the molecular formula C22H21N5O3S2 and a molecular weight of 467.58 g/mol. Its IUPAC name is 3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 23746182 |
| Molecular Formula | C22H21N5O3S2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC(C)Cc1ccc(C#N)c(SCCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)n1 |
| InChI | InChI=1S/C22H21N5O3S2/c1-14(2)10-17-7-6-16(12-23)21(24-17)31-9-8-20(28)26-22-25-19(13-32-22)15-4-3-5-18(11-15)27(29)30/h3-7,11,13-14H,8-10H2,1-2H3,(H,25,26,28) |
| InChIKey | OPCWATGMQPROCL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|