C20H17N5O3S2 — CID 23861595
3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 23861595) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 23861595 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 3-[(3-cyano-4,6-dimethyl-2-pyridinyl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1cc(C)c(C#N)c(SCCC(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)n1 |
| InChI | InChI=1S/C20H17N5O3S2/c1-12-8-13(2)22-19(16(12)10-21)29-7-6-18(26)24-20-23-17(11-30-20)14-4-3-5-15(9-14)25(27)28/h3-5,8-9,11H,6-7H2,1-2H3,(H,23,24,26) |
| InChIKey | QRIAAKCIEWPXLH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|