C20H21N3O3S — CID 21233167
3-[3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]propanoylamino]benzoic acid (PubChem CID 21233167) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-[3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]propanoylamino]benzoic acid.
| Compound Name | 3-[3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 21233167 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-[3-[[3-cyano-6-(2-methylpropyl)-2-pyridinyl]sulfanyl]propanoylamino]benzoic acid |
| SMILES | CC(C)Cc1ccc(C#N)c(SCCC(=O)Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C20H21N3O3S/c1-13(2)10-17-7-6-15(12-21)19(23-17)27-9-8-18(24)22-16-5-3-4-14(11-16)20(25)26/h3-7,11,13H,8-10H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | JVJKSIKRDHHXTQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |