C10H10N4OS — CID 43551246
[4-(3-aminophenyl)-1,3-thiazol-2-yl]urea (PubChem CID 43551246) has the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. Its IUPAC name is [4-(3-aminophenyl)-1,3-thiazol-2-yl]urea.
| Compound Name | [4-(3-aminophenyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 43551246 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | [4-(3-aminophenyl)-1,3-thiazol-2-yl]urea |
| SMILES | NC(=O)Nc1nc(-c2cccc(N)c2)cs1 |
| InChI | InChI=1S/C10H10N4OS/c11-7-3-1-2-6(4-7)8-5-16-10(13-8)14-9(12)15/h1-5H,11H2,(H3,12,13,14,15) |
| InChIKey | LKWPRDXOWKGNDT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|