C24H21N3OS — CID 28861500
N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,3-diphenylpropanamide (PubChem CID 28861500) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 28861500 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,3-diphenylpropanamide |
| SMILES | Nc1cccc(-c2csc(NC(=O)CC(c3ccccc3)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H21N3OS/c25-20-13-7-12-19(14-20)22-16-29-24(26-22)27-23(28)15-21(17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-14,16,21H,15,25H2,(H,26,27,28) |
| InChIKey | OHKVIAGRUBEKOF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|