C20H18N2O3S — CID 2039739
(3R)-5-oxo-3-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid (PubChem CID 2039739) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is (3R)-5-oxo-3-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid.
| Compound Name | (3R)-5-oxo-3-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 2039739 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (3R)-5-oxo-3-phenyl-5-[(4-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid |
| SMILES | O=C(O)C[C@@H](CC(=O)Nc1nc(-c2ccccc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O3S/c23-18(11-16(12-19(24)25)14-7-3-1-4-8-14)22-20-21-17(13-26-20)15-9-5-2-6-10-15/h1-10,13,16H,11-12H2,(H,24,25)(H,21,22,23)/t16-/m1/s1 |
| InChIKey | YWIMYIAQCSEKCJ-MRXNPFEDSA-N |
| XLogP | 4.40 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |