C19H14N4OS2 — CID 13089293
1,3-bis(4-phenyl-1,3-thiazol-2-yl)urea (PubChem CID 13089293) has the molecular formula C19H14N4OS2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1,3-bis(4-phenyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1,3-bis(4-phenyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 13089293 |
| Molecular Formula | C19H14N4OS2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1,3-bis(4-phenyl-1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H14N4OS2/c24-17(22-18-20-15(11-25-18)13-7-3-1-4-8-13)23-19-21-16(12-26-19)14-9-5-2-6-10-14/h1-12H,(H2,20,21,22,23,24) |
| InChIKey | SNRLIFHILWTKQF-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |