C18H13N5OS2 — CID 18771890
1-(4-phenyl-1,3-thiazol-2-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea (PubChem CID 18771890) has the molecular formula C18H13N5OS2 and a molecular weight of 379.47 g/mol. Its IUPAC name is 1-(4-phenyl-1,3-thiazol-2-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-(4-phenyl-1,3-thiazol-2-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 18771890 |
| Molecular Formula | C18H13N5OS2 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1-(4-phenyl-1,3-thiazol-2-yl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
| SMILES | O=C(Nc1csc(-c2cccnc2)n1)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H13N5OS2/c24-17(22-15-11-25-16(21-15)13-7-4-8-19-9-13)23-18-20-14(10-26-18)12-5-2-1-3-6-12/h1-11H,(H2,20,22,23,24) |
| InChIKey | NELFEFXSVCRQBC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |