C14H11N5O2S — CID 18771602
1-(3-hydroxy-2-pyridinyl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea (PubChem CID 18771602) has the molecular formula C14H11N5O2S and a molecular weight of 313.34 g/mol. Its IUPAC name is 1-(3-hydroxy-2-pyridinyl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-(3-hydroxy-2-pyridinyl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 18771602 |
| Molecular Formula | C14H11N5O2S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-(3-hydroxy-2-pyridinyl)-3-(2-pyridin-3-yl-1,3-thiazol-4-yl)urea |
| SMILES | O=C(Nc1csc(-c2cccnc2)n1)Nc1ncccc1O |
| InChI | InChI=1S/C14H11N5O2S/c20-10-4-2-6-16-12(10)19-14(21)18-11-8-22-13(17-11)9-3-1-5-15-7-9/h1-8,20H,(H2,16,18,19,21) |
| InChIKey | LWHNIINZEBZVOM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |