C9H7N3O2S — CID 604917
N-hydroxy-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 604917) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is N-hydroxy-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-hydroxy-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 604917 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | N-hydroxy-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NO)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C9H7N3O2S/c13-8(12-14)7-5-15-9(11-7)6-2-1-3-10-4-6/h1-5,14H,(H,12,13) |
| InChIKey | XXMNXKFDTRMRKI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|