C15H9Cl2N3OS — CID 110651203
N-(2,3-dichlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 110651203) has the molecular formula C15H9Cl2N3OS and a molecular weight of 350.23 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110651203 |
| Molecular Formula | C15H9Cl2N3OS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H9Cl2N3OS/c16-10-4-1-5-11(13(10)17)19-14(21)12-8-22-15(20-12)9-3-2-6-18-7-9/h1-8H,(H,19,21) |
| InChIKey | AVIMILUXCSMBCC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |