C17H10N4OS2 — CID 175265157
bis(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone (PubChem CID 175265157) has the molecular formula C17H10N4OS2 and a molecular weight of 350.43 g/mol. Its IUPAC name is bis(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone.
| Compound Name | bis(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 175265157 |
| Molecular Formula | C17H10N4OS2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | bis(2-pyridin-3-yl-1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1csc(-c2cccnc2)n1)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H10N4OS2/c22-15(13-9-23-16(20-13)11-3-1-5-18-7-11)14-10-24-17(21-14)12-4-2-6-19-8-12/h1-10H |
| InChIKey | FXULXLWOLMCMLA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |