C9H8N2O2S — CID 130242448
(2-pyridin-3-yl-1,3-thiazol-4-yl)methanediol (PubChem CID 130242448) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is (2-pyridin-3-yl-1,3-thiazol-4-yl)methanediol.
| Compound Name | (2-pyridin-3-yl-1,3-thiazol-4-yl)methanediol |
|---|---|
| PubChem CID | 130242448 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (2-pyridin-3-yl-1,3-thiazol-4-yl)methanediol |
| SMILES | OC(O)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C9H8N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-5,9,12-13H |
| InChIKey | NUAGTMWWWLMABL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|