C13H14N2O2S — CID 18913481
4-[2-(1,3-dioxolan-2-yl)ethyl]-2-pyridin-3-yl-1,3-thiazole (PubChem CID 18913481) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-[2-(1,3-dioxolan-2-yl)ethyl]-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 4-[2-(1,3-dioxolan-2-yl)ethyl]-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 18913481 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 4-[2-(1,3-dioxolan-2-yl)ethyl]-2-pyridin-3-yl-1,3-thiazole |
| SMILES | c1cncc(-c2nc(CCC3OCCO3)cs2)c1 |
| InChI | InChI=1S/C13H14N2O2S/c1-2-10(8-14-5-1)13-15-11(9-18-13)3-4-12-16-6-7-17-12/h1-2,5,8-9,12H,3-4,6-7H2 |
| InChIKey | YZAWVTDWFMSRCI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |