C14H17N3S2 — CID 50972952
N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine (PubChem CID 50972952) has the molecular formula C14H17N3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine.
| Compound Name | N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine |
|---|---|
| PubChem CID | 50972952 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[2-(2-pyridin-3-yl-1,3-thiazol-4-yl)ethyl]thiolan-3-amine |
| SMILES | c1cncc(-c2nc(CCNC3CCSC3)cs2)c1 |
| InChI | InChI=1S/C14H17N3S2/c1-2-11(8-15-5-1)14-17-13(10-19-14)3-6-16-12-4-7-18-9-12/h1-2,5,8,10,12,16H,3-4,6-7,9H2 |
| InChIKey | JGHDRDUUCDEUFM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |