C14H16N2S — CID 67547913
4-(cyclopentylmethyl)-2-pyridin-3-yl-1,3-thiazole (PubChem CID 67547913) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-2-pyridin-3-yl-1,3-thiazole.
| Compound Name | 4-(cyclopentylmethyl)-2-pyridin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 67547913 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-(cyclopentylmethyl)-2-pyridin-3-yl-1,3-thiazole |
| SMILES | c1cncc(-c2nc(CC3CCCC3)cs2)c1 |
| InChI | InChI=1S/C14H16N2S/c1-2-5-11(4-1)8-13-10-17-14(16-13)12-6-3-7-15-9-12/h3,6-7,9-11H,1-2,4-5,8H2 |
| InChIKey | NAAOCALGGPMGIO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |