C17H11N3O2S — CID 91901612
2-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione (PubChem CID 91901612) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91901612 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C17H11N3O2S/c21-16-13-5-1-2-6-14(13)17(22)20(16)9-12-10-23-15(19-12)11-4-3-7-18-8-11/h1-8,10H,9H2 |
| InChIKey | QSWBNWUVFVNGOE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|