C17H14N2O2S — CID 8918530
benzyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate (PubChem CID 8918530) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is benzyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | benzyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 8918530 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | benzyl 2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2cccnc2)n1)OCc1ccccc1 |
| InChI | InChI=1S/C17H14N2O2S/c20-16(21-11-13-5-2-1-3-6-13)9-15-12-22-17(19-15)14-7-4-8-18-10-14/h1-8,10,12H,9,11H2 |
| InChIKey | XCSREVSGTBPZNT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |