C19H17NO2S — CID 55319347
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-phenylacetate (PubChem CID 55319347) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-phenylacetate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-phenylacetate |
|---|---|
| PubChem CID | 55319347 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-phenylacetate |
| SMILES | Cc1ccc(-c2nc(COC(=O)Cc3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C19H17NO2S/c1-14-7-9-16(10-8-14)19-20-17(13-23-19)12-22-18(21)11-15-5-3-2-4-6-15/h2-10,13H,11-12H2,1H3 |
| InChIKey | ZXDRSEGYFYZGAS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |