C15H16N2O3S — CID 75412679
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-acetamidoacetate (PubChem CID 75412679) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-acetamidoacetate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-acetamidoacetate |
|---|---|
| PubChem CID | 75412679 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 2-acetamidoacetate |
| SMILES | CC(=O)NCC(=O)OCc1csc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10-3-5-12(6-4-10)15-17-13(9-21-15)8-20-14(19)7-16-11(2)18/h3-6,9H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | ANEUGNBHTOMPJB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |