C16H18N2O3S — CID 7197599
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-acetamidopropanoate (PubChem CID 7197599) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-acetamidopropanoate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-acetamidopropanoate |
|---|---|
| PubChem CID | 7197599 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 3-acetamidopropanoate |
| SMILES | CC(=O)NCCC(=O)OCc1csc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C16H18N2O3S/c1-11-3-5-13(6-4-11)16-18-14(10-22-16)9-21-15(20)7-8-17-12(2)19/h3-6,10H,7-9H2,1-2H3,(H,17,19) |
| InChIKey | HZDMWLHCHCVUAA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |