C21H17BrN4O3S — CID 108748995
4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 108748995) has the molecular formula C21H17BrN4O3S and a molecular weight of 485.36 g/mol. Its IUPAC name is 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 108748995 |
| Molecular Formula | C21H17BrN4O3S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 4-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(2-pyridin-3-yl-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc(Br)cc2C1=O)NCc1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C21H17BrN4O3S/c22-14-5-6-16-17(9-14)21(29)26(20(16)28)8-2-4-18(27)24-11-15-12-30-19(25-15)13-3-1-7-23-10-13/h1,3,5-7,9-10,12H,2,4,8,11H2,(H,24,27) |
| InChIKey | RYAKTVKQUVETDE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|