C20H17N5O4 — CID 110318736
4-(1,3-dioxoisoindol-2-yl)-N-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)methyl]butanamide (PubChem CID 110318736) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 110318736 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCc1nnc(-c2cccnc2)o1 |
| InChI | InChI=1S/C20H17N5O4/c26-16(22-12-17-23-24-18(29-17)13-5-3-9-21-11-13)8-4-10-25-19(27)14-6-1-2-7-15(14)20(25)28/h1-3,5-7,9,11H,4,8,10,12H2,(H,22,26) |
| InChIKey | OEHCIJAKKXNQOA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|