C16H15N3O4 — CID 110660366
3-(1,3-dioxoisoindol-2-yl)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]propanamide (PubChem CID 110660366) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110660366 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(5-methyl-1,3-oxazol-2-yl)methyl]propanamide |
| SMILES | Cc1cnc(CNC(=O)CCN2C(=O)c3ccccc3C2=O)o1 |
| InChI | InChI=1S/C16H15N3O4/c1-10-8-18-14(23-10)9-17-13(20)6-7-19-15(21)11-4-2-3-5-12(11)16(19)22/h2-5,8H,6-7,9H2,1H3,(H,17,20) |
| InChIKey | IKVNNFUSNKBZTL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|