C15H13N3O3S — CID 49346171
3-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-4-ylmethyl)propanamide (PubChem CID 49346171) has the molecular formula C15H13N3O3S and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-4-ylmethyl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 49346171 |
| Molecular Formula | C15H13N3O3S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(1,3-thiazol-4-ylmethyl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NCc1cscn1 |
| InChI | InChI=1S/C15H13N3O3S/c19-13(16-7-10-8-22-9-17-10)5-6-18-14(20)11-3-1-2-4-12(11)15(18)21/h1-4,8-9H,5-7H2,(H,16,19) |
| InChIKey | ZYZHSSDNOALMCC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|