C8H11ClN2OS — CID 63831533
4-chloro-N-(1,3-thiazol-4-ylmethyl)butanamide (PubChem CID 63831533) has the molecular formula C8H11ClN2OS and a molecular weight of 218.71 g/mol. Its IUPAC name is 4-chloro-N-(1,3-thiazol-4-ylmethyl)butanamide.
| Compound Name | 4-chloro-N-(1,3-thiazol-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 63831533 |
| Molecular Formula | C8H11ClN2OS |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 4-chloro-N-(1,3-thiazol-4-ylmethyl)butanamide |
| SMILES | O=C(CCCCl)NCc1cscn1 |
| InChI | InChI=1S/C8H11ClN2OS/c9-3-1-2-8(12)10-4-7-5-13-6-11-7/h5-6H,1-4H2,(H,10,12) |
| InChIKey | ZSNXHQPOQQZWMJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|