C9H12N2OS — CID 110679374
N-prop-2-enyl-3-(1,3-thiazol-4-yl)propanamide (PubChem CID 110679374) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is N-prop-2-enyl-3-(1,3-thiazol-4-yl)propanamide.
| Compound Name | N-prop-2-enyl-3-(1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110679374 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | N-prop-2-enyl-3-(1,3-thiazol-4-yl)propanamide |
| SMILES | C=CCNC(=O)CCc1cscn1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-5-10-9(12)4-3-8-6-13-7-11-8/h2,6-7H,1,3-5H2,(H,10,12) |
| InChIKey | RIQRCZSNNZFHKJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|