C9H15N3OS — CID 119501389
N-[2-(methylamino)ethyl]-3-(1,3-thiazol-4-yl)propanamide (PubChem CID 119501389) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-3-(1,3-thiazol-4-yl)propanamide.
| Compound Name | N-[2-(methylamino)ethyl]-3-(1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 119501389 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-[2-(methylamino)ethyl]-3-(1,3-thiazol-4-yl)propanamide |
| SMILES | CNCCNC(=O)CCc1cscn1 |
| InChI | InChI=1S/C9H15N3OS/c1-10-4-5-11-9(13)3-2-8-6-14-7-12-8/h6-7,10H,2-5H2,1H3,(H,11,13) |
| InChIKey | SOBNVFAZCQYYPQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|