C11H19N3OS — CID 82688020
5-amino-4-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentanamide (PubChem CID 82688020) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 5-amino-4-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentanamide.
| Compound Name | 5-amino-4-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 82688020 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 5-amino-4-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentanamide |
| SMILES | CC(CN)CCC(=O)NCCc1cscn1 |
| InChI | InChI=1S/C11H19N3OS/c1-9(6-12)2-3-11(15)13-5-4-10-7-16-8-14-10/h7-9H,2-6,12H2,1H3,(H,13,15) |
| InChIKey | KZSYPUZGVIUBNQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |