C9H15N3O2S — CID 106112900
3-amino-2-methoxy-N-[2-(1,3-thiazol-4-yl)ethyl]propanamide (PubChem CID 106112900) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 3-amino-2-methoxy-N-[2-(1,3-thiazol-4-yl)ethyl]propanamide.
| Compound Name | 3-amino-2-methoxy-N-[2-(1,3-thiazol-4-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 106112900 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-amino-2-methoxy-N-[2-(1,3-thiazol-4-yl)ethyl]propanamide |
| SMILES | COC(CN)C(=O)NCCc1cscn1 |
| InChI | InChI=1S/C9H15N3O2S/c1-14-8(4-10)9(13)11-3-2-7-5-15-6-12-7/h5-6,8H,2-4,10H2,1H3,(H,11,13) |
| InChIKey | DRKSHNLIXNSDGI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |