C10H16N2O2S — CID 124604358
methyl (2R)-2-[2-(1,3-thiazol-4-yl)ethylamino]butanoate (PubChem CID 124604358) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is methyl (2R)-2-[2-(1,3-thiazol-4-yl)ethylamino]butanoate.
| Compound Name | methyl (2R)-2-[2-(1,3-thiazol-4-yl)ethylamino]butanoate |
|---|---|
| PubChem CID | 124604358 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl (2R)-2-[2-(1,3-thiazol-4-yl)ethylamino]butanoate |
| SMILES | CC[C@@H](NCCc1cscn1)C(=O)OC |
| InChI | InChI=1S/C10H16N2O2S/c1-3-9(10(13)14-2)11-5-4-8-6-15-7-12-8/h6-7,9,11H,3-5H2,1-2H3/t9-/m1/s1 |
| InChIKey | MCHUBKVHBSCONK-SECBINFHSA-N |
| XLogP | 1.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |