C11H19N3OS — CID 115731929
N,N-dimethyl-3-[2-(1,3-thiazol-4-yl)ethylamino]butanamide (PubChem CID 115731929) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-(1,3-thiazol-4-yl)ethylamino]butanamide.
| Compound Name | N,N-dimethyl-3-[2-(1,3-thiazol-4-yl)ethylamino]butanamide |
|---|---|
| PubChem CID | 115731929 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N,N-dimethyl-3-[2-(1,3-thiazol-4-yl)ethylamino]butanamide |
| SMILES | CC(CC(=O)N(C)C)NCCc1cscn1 |
| InChI | InChI=1S/C11H19N3OS/c1-9(6-11(15)14(2)3)12-5-4-10-7-16-8-13-10/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | NZVIDYPKNNIDNK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |