C11H21N3S — CID 104682227
2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentane-1,5-diamine (PubChem CID 104682227) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentane-1,5-diamine.
| Compound Name | 2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 104682227 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-methyl-N-[2-(1,3-thiazol-4-yl)ethyl]pentane-1,5-diamine |
| SMILES | CC(CCCN)CNCCc1cscn1 |
| InChI | InChI=1S/C11H21N3S/c1-10(3-2-5-12)7-13-6-4-11-8-15-9-14-11/h8-10,13H,2-7,12H2,1H3 |
| InChIKey | KWFFEZMFBICCKC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|