C13H25N3S — CID 65296150
2-methyl-1-N-[2-(1,3-thiazol-4-yl)ethyl]heptane-1,6-diamine (PubChem CID 65296150) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is 2-methyl-1-N-[2-(1,3-thiazol-4-yl)ethyl]heptane-1,6-diamine.
| Compound Name | 2-methyl-1-N-[2-(1,3-thiazol-4-yl)ethyl]heptane-1,6-diamine |
|---|---|
| PubChem CID | 65296150 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-methyl-1-N-[2-(1,3-thiazol-4-yl)ethyl]heptane-1,6-diamine |
| SMILES | CC(N)CCCC(C)CNCCc1cscn1 |
| InChI | InChI=1S/C13H25N3S/c1-11(4-3-5-12(2)14)8-15-7-6-13-9-17-10-16-13/h9-12,15H,3-8,14H2,1-2H3 |
| InChIKey | VZZGBPFTBJWLFY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|