C8H15N3S — CID 63826093
1-N-(1,3-thiazol-4-ylmethyl)butane-1,2-diamine (PubChem CID 63826093) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 1-N-(1,3-thiazol-4-ylmethyl)butane-1,2-diamine.
| Compound Name | 1-N-(1,3-thiazol-4-ylmethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 63826093 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-N-(1,3-thiazol-4-ylmethyl)butane-1,2-diamine |
| SMILES | CCC(N)CNCc1cscn1 |
| InChI | InChI=1S/C8H15N3S/c1-2-7(9)3-10-4-8-5-12-6-11-8/h5-7,10H,2-4,9H2,1H3 |
| InChIKey | ZMBLKGKOBSXPNJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |