C15H20N2S — CID 103624008
3-methyl-2-phenyl-N-(1,3-thiazol-4-ylmethyl)butan-1-amine (PubChem CID 103624008) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 3-methyl-2-phenyl-N-(1,3-thiazol-4-ylmethyl)butan-1-amine.
| Compound Name | 3-methyl-2-phenyl-N-(1,3-thiazol-4-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 103624008 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-methyl-2-phenyl-N-(1,3-thiazol-4-ylmethyl)butan-1-amine |
| SMILES | CC(C)C(CNCc1cscn1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2S/c1-12(2)15(13-6-4-3-5-7-13)9-16-8-14-10-18-11-17-14/h3-7,10-12,15-16H,8-9H2,1-2H3 |
| InChIKey | WBAZGCDMZFLEAX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |