C10H18N2O2S — CID 78914468
2,2-diethoxy-N-(1,3-thiazol-4-ylmethyl)ethanamine (PubChem CID 78914468) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 2,2-diethoxy-N-(1,3-thiazol-4-ylmethyl)ethanamine.
| Compound Name | 2,2-diethoxy-N-(1,3-thiazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 78914468 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,2-diethoxy-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| SMILES | CCOC(CNCc1cscn1)OCC |
| InChI | InChI=1S/C10H18N2O2S/c1-3-13-10(14-4-2)6-11-5-9-7-15-8-12-9/h7-8,10-11H,3-6H2,1-2H3 |
| InChIKey | UDXPTGYIUVYFAU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|