C9H17N3S — CID 63826089
1-N-(1,3-thiazol-4-ylmethyl)pentane-1,2-diamine (PubChem CID 63826089) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-N-(1,3-thiazol-4-ylmethyl)pentane-1,2-diamine.
| Compound Name | 1-N-(1,3-thiazol-4-ylmethyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 63826089 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-N-(1,3-thiazol-4-ylmethyl)pentane-1,2-diamine |
| SMILES | CCCC(N)CNCc1cscn1 |
| InChI | InChI=1S/C9H17N3S/c1-2-3-8(10)4-11-5-9-6-13-7-12-9/h6-8,11H,2-5,10H2,1H3 |
| InChIKey | QKDKQLLPQOQCLS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |