C10H25N3 — CID 139611076
1-N-(2-aminopentyl)pentane-1,2-diamine (PubChem CID 139611076) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-N-(2-aminopentyl)pentane-1,2-diamine.
| Compound Name | 1-N-(2-aminopentyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 139611076 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 1-N-(2-aminopentyl)pentane-1,2-diamine |
| SMILES | CCCC(N)CNCC(N)CCC |
| InChI | InChI=1S/C10H25N3/c1-3-5-9(11)7-13-8-10(12)6-4-2/h9-10,13H,3-8,11-12H2,1-2H3 |
| InChIKey | KNQYQFZIDOEAMF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |