C11H28N4 — CID 88775596
5-N-(2-aminohexyl)pentane-1,2,5-triamine (PubChem CID 88775596) has the molecular formula C11H28N4 and a molecular weight of 216.37 g/mol. Its IUPAC name is 5-N-(2-aminohexyl)pentane-1,2,5-triamine.
| Compound Name | 5-N-(2-aminohexyl)pentane-1,2,5-triamine |
|---|---|
| PubChem CID | 88775596 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | 5-N-(2-aminohexyl)pentane-1,2,5-triamine |
| SMILES | CCCCC(N)CNCCCC(N)CN |
| InChI | InChI=1S/C11H28N4/c1-2-3-5-11(14)9-15-7-4-6-10(13)8-12/h10-11,15H,2-9,12-14H2,1H3 |
| InChIKey | JBNYKHVCFZUAHH-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|