C7H18N2 — CID 89357717
(2S)-1-N-methylhexane-1,2-diamine (PubChem CID 89357717) has the molecular formula C7H18N2 and a molecular weight of 130.23 g/mol. Its IUPAC name is (2S)-1-N-methylhexane-1,2-diamine.
| Compound Name | (2S)-1-N-methylhexane-1,2-diamine |
|---|---|
| PubChem CID | 89357717 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | (2S)-1-N-methylhexane-1,2-diamine |
| SMILES | CCCC[C@H](N)CNC |
| InChI | InChI=1S/C7H18N2/c1-3-4-5-7(8)6-9-2/h7,9H,3-6,8H2,1-2H3/t7-/m0/s1 |
| InChIKey | XLSFTUPXUYQGAL-ZETCQYMHSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |