About 2-aminohexylurea
2-aminohexylurea (PubChem CID 171485886) has the molecular formula C7H17N3O
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-aminohexylurea.
Molecular Properties
| Compound Name | 2-aminohexylurea |
| PubChem CID | 171485886 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 2-aminohexylurea |
| SMILES | CCCCC(N)CNC(N)=O |
| InChI | InChI=1S/C7H17N3O/c1-2-3-4-6(8)5-10-7(9)11/h6H,2-5,8H2,1H3,(H3,9,10,11) |
| InChIKey | QJVQEUMADZQXCZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminohexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminohexylurea?
The IUPAC name of 2-aminohexylurea (CID 171485886) is 2-aminohexylurea.
What is the SMILES notation for 2-aminohexylurea?
The canonical SMILES for 2-aminohexylurea is CCCCC(N)CNC(N)=O.
What is the InChIKey of 2-aminohexylurea?
The InChIKey is QJVQEUMADZQXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3O/c1-2-3-4-6(8)5-10-7(9)11/h6H,2-5,8H2,1H3,(H3,9,10,11).
What are the key properties of 2-aminohexylurea?
2-aminohexylurea has a molecular weight of 159.23 g/mol, XLogP of 0.17, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminohexylurea is sourced from PubChem (CID 171485886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).