C17H37N3O — CID 22381316
[3-(butylamino)-2,4-diethyloctyl]urea (PubChem CID 22381316) has the molecular formula C17H37N3O and a molecular weight of 299.50 g/mol. Its IUPAC name is [3-(butylamino)-2,4-diethyloctyl]urea.
| Compound Name | [3-(butylamino)-2,4-diethyloctyl]urea |
|---|---|
| PubChem CID | 22381316 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | [3-(butylamino)-2,4-diethyloctyl]urea |
| SMILES | CCCCNC(C(CC)CCCC)C(CC)CNC(N)=O |
| InChI | InChI=1S/C17H37N3O/c1-5-9-11-14(7-3)16(19-12-10-6-2)15(8-4)13-20-17(18)21/h14-16,19H,5-13H2,1-4H3,(H3,18,20,21) |
| InChIKey | GPVSQSKKAUVDOG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|