About 2-methylbutylurea
2-methylbutylurea (PubChem CID 22179633) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-methylbutylurea.
Molecular Properties
| Compound Name | 2-methylbutylurea |
| PubChem CID | 22179633 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 2-methylbutylurea |
| SMILES | CCC(C)CNC(N)=O |
| InChI | InChI=1S/C6H14N2O/c1-3-5(2)4-8-6(7)9/h5H,3-4H2,1-2H3,(H3,7,8,9) |
| InChIKey | ZTICQDHLCSAUML-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylbutylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutylurea?
The IUPAC name of 2-methylbutylurea (CID 22179633) is 2-methylbutylurea.
What is the SMILES notation for 2-methylbutylurea?
The canonical SMILES for 2-methylbutylurea is CCC(C)CNC(N)=O.
What is the InChIKey of 2-methylbutylurea?
The InChIKey is ZTICQDHLCSAUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O/c1-3-5(2)4-8-6(7)9/h5H,3-4H2,1-2H3,(H3,7,8,9).
What are the key properties of 2-methylbutylurea?
2-methylbutylurea has a molecular weight of 130.19 g/mol, XLogP of 0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutylurea is sourced from PubChem (CID 22179633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).