C5H12N4O2 — CID 3246036
[(2R)-1-(carbamoylamino)propan-2-yl]urea (PubChem CID 3246036) has the molecular formula C5H12N4O2 and a molecular weight of 160.18 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)propan-2-yl]urea.
| Compound Name | [(2R)-1-(carbamoylamino)propan-2-yl]urea |
|---|---|
| PubChem CID | 3246036 |
| Molecular Formula | C5H12N4O2 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | [(2R)-1-(carbamoylamino)propan-2-yl]urea |
| SMILES | C[C@H](CNC(N)=O)NC(N)=O |
| InChI | InChI=1S/C5H12N4O2/c1-3(9-5(7)11)2-8-4(6)10/h3H,2H2,1H3,(H3,6,8,10)(H3,7,9,11)/t3-/m1/s1 |
| InChIKey | JTZUXKIKHMIVSD-GSVOUGTGSA-N |
| XLogP | -1.29 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |